2-anilino-4,4-dinitrobutanoic acid

C10H11N3O6 — CID 143450894

IUPAC2-anilino-4,4-dinitrobutanoic acid
SMILESO=C(O)C(CC([N+](=O)[O-])[N+](=O)[O-])Nc1ccccc1
InChIInChI=1S/C10H11N3O6/c14-10(15)8(6-9(12(16)17)13(18)19)11-7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,14,15)
InChIKeyDGJOVDZUBBPBOI-UHFFFAOYSA-N
MW269.21 g/mol
LogP0.82
Rot. Bonds7

About 2-anilino-4,4-dinitrobutanoic acid

2-anilino-4,4-dinitrobutanoic acid (PubChem CID 143450894) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is 2-anilino-4,4-dinitrobutanoic acid.

Molecular Properties

Compound Name2-anilino-4,4-dinitrobutanoic acid
PubChem CID143450894
Molecular FormulaC10H11N3O6
Molecular Weight269.21 g/mol
Exact Mass269.06
IUPAC Name2-anilino-4,4-dinitrobutanoic acid
SMILESO=C(O)C(CC([N+](=O)[O-])[N+](=O)[O-])Nc1ccccc1
InChIInChI=1S/C10H11N3O6/c14-10(15)8(6-9(12(16)17)13(18)19)11-7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,14,15)
InChIKeyDGJOVDZUBBPBOI-UHFFFAOYSA-N
XLogP0.82
TPSA135.61 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.21
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-anilino-4,4-dinitrobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-anilino-4,4-dinitrobutanoic acid?
The IUPAC name of 2-anilino-4,4-dinitrobutanoic acid (CID 143450894) is 2-anilino-4,4-dinitrobutanoic acid.
What is the SMILES notation for 2-anilino-4,4-dinitrobutanoic acid?
The canonical SMILES for 2-anilino-4,4-dinitrobutanoic acid is O=C(O)C(CC([N+](=O)[O-])[N+](=O)[O-])Nc1ccccc1.
What is the InChIKey of 2-anilino-4,4-dinitrobutanoic acid?
The InChIKey is DGJOVDZUBBPBOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O6/c14-10(15)8(6-9(12(16)17)13(18)19)11-7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,14,15).
What are the key properties of 2-anilino-4,4-dinitrobutanoic acid?
2-anilino-4,4-dinitrobutanoic acid has a molecular weight of 269.21 g/mol, XLogP of 0.82, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-4,4-dinitrobutanoic acid is sourced from PubChem (CID 143450894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).