C12H13NO4S — CID 175133193
2-[(2-acetylbenzoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 175133193) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-[(2-acetylbenzoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-acetylbenzoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175133193 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[(2-acetylbenzoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)c1ccccc1C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C12H13NO4S/c1-7(14)8-4-2-3-5-9(8)11(15)13-10(6-18)12(16)17/h2-5,10,18H,6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | BTJZVSKAQCJWEI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|