C24H23NO3S — CID 149150781
(2S)-4-benzylsulfanyl-2-[(2-phenylbenzoyl)amino]butanoic acid (PubChem CID 149150781) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is (2S)-4-benzylsulfanyl-2-[(2-phenylbenzoyl)amino]butanoic acid.
| Compound Name | (2S)-4-benzylsulfanyl-2-[(2-phenylbenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 149150781 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (2S)-4-benzylsulfanyl-2-[(2-phenylbenzoyl)amino]butanoic acid |
| SMILES | O=C(N[C@@H](CCSCc1ccccc1)C(=O)O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H23NO3S/c26-23(21-14-8-7-13-20(21)19-11-5-2-6-12-19)25-22(24(27)28)15-16-29-17-18-9-3-1-4-10-18/h1-14,22H,15-17H2,(H,25,26)(H,27,28)/t22-/m0/s1 |
| InChIKey | ANMNOIHGQWFXFL-QFIPXVFZSA-N |
| XLogP | 4.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|