C23H24N2O — CID 68727278
N-[(2R)-1-amino-4-phenylbutan-2-yl]-2-phenylbenzamide (PubChem CID 68727278) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[(2R)-1-amino-4-phenylbutan-2-yl]-2-phenylbenzamide.
| Compound Name | N-[(2R)-1-amino-4-phenylbutan-2-yl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 68727278 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(2R)-1-amino-4-phenylbutan-2-yl]-2-phenylbenzamide |
| SMILES | NC[C@@H](CCc1ccccc1)NC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H24N2O/c24-17-20(16-15-18-9-3-1-4-10-18)25-23(26)22-14-8-7-13-21(22)19-11-5-2-6-12-19/h1-14,20H,15-17,24H2,(H,25,26)/t20-/m1/s1 |
| InChIKey | VGTHWRMPUYXRFQ-HXUWFJFHSA-N |
| XLogP | 4.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |