C11H12F2N2OS — CID 62094599
N-(4-amino-4-sulfanylidenebutan-2-yl)-2,6-difluorobenzamide (PubChem CID 62094599) has the molecular formula C11H12F2N2OS and a molecular weight of 258.29 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-2,6-difluorobenzamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 62094599 |
| Molecular Formula | C11H12F2N2OS |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2,6-difluorobenzamide |
| SMILES | CC(CC(N)=S)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H12F2N2OS/c1-6(5-9(14)17)15-11(16)10-7(12)3-2-4-8(10)13/h2-4,6H,5H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | XHBRWUVKOHNZJY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|