C10H11BrFNO2 — CID 107016869
N-(1-bromopropan-2-yl)-2-fluoro-6-hydroxybenzamide (PubChem CID 107016869) has the molecular formula C10H11BrFNO2 and a molecular weight of 276.11 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-(1-bromopropan-2-yl)-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 107016869 |
| Molecular Formula | C10H11BrFNO2 |
| Molecular Weight | 276.11 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-(1-bromopropan-2-yl)-2-fluoro-6-hydroxybenzamide |
| SMILES | CC(CBr)NC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C10H11BrFNO2/c1-6(5-11)13-10(15)9-7(12)3-2-4-8(9)14/h2-4,6,14H,5H2,1H3,(H,13,15) |
| InChIKey | KWFBYVGSKRREGP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|