C12H16BrNO3 — CID 107691210
N-(4-bromo-3-methylbutan-2-yl)-2,6-dihydroxybenzamide (PubChem CID 107691210) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is N-(4-bromo-3-methylbutan-2-yl)-2,6-dihydroxybenzamide.
| Compound Name | N-(4-bromo-3-methylbutan-2-yl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107691210 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(4-bromo-3-methylbutan-2-yl)-2,6-dihydroxybenzamide |
| SMILES | CC(CBr)C(C)NC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C12H16BrNO3/c1-7(6-13)8(2)14-12(17)11-9(15)4-3-5-10(11)16/h3-5,7-8,15-16H,6H2,1-2H3,(H,14,17) |
| InChIKey | MCTTVXGHDDQHJP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|