C11H14BrNO4 — CID 106184915
N-(1-bromo-3-methoxypropan-2-yl)-2,6-dihydroxybenzamide (PubChem CID 106184915) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-2,6-dihydroxybenzamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 106184915 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-2,6-dihydroxybenzamide |
| SMILES | COCC(CBr)NC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C11H14BrNO4/c1-17-6-7(5-12)13-11(16)10-8(14)3-2-4-9(10)15/h2-4,7,14-15H,5-6H2,1H3,(H,13,16) |
| InChIKey | SVUMHLQLMHKCCX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|