C11H13ClFNO3 — CID 106183536
N-(1-chloro-3-methoxypropan-2-yl)-2-fluoro-6-hydroxybenzamide (PubChem CID 106183536) has the molecular formula C11H13ClFNO3 and a molecular weight of 261.68 g/mol. Its IUPAC name is N-(1-chloro-3-methoxypropan-2-yl)-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-(1-chloro-3-methoxypropan-2-yl)-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 106183536 |
| Molecular Formula | C11H13ClFNO3 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(1-chloro-3-methoxypropan-2-yl)-2-fluoro-6-hydroxybenzamide |
| SMILES | COCC(CCl)NC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C11H13ClFNO3/c1-17-6-7(5-12)14-11(16)10-8(13)3-2-4-9(10)15/h2-4,7,15H,5-6H2,1H3,(H,14,16) |
| InChIKey | MLHITCWIAFQWCG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|