C13H18FNO4 — CID 103850864
2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-6-methoxybenzamide (PubChem CID 103850864) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-6-methoxybenzamide.
| Compound Name | 2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-6-methoxybenzamide |
|---|---|
| PubChem CID | 103850864 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-6-methoxybenzamide |
| SMILES | COCC(CCO)NC(=O)c1c(F)cccc1OC |
| InChI | InChI=1S/C13H18FNO4/c1-18-8-9(6-7-16)15-13(17)12-10(14)4-3-5-11(12)19-2/h3-5,9,16H,6-8H2,1-2H3,(H,15,17) |
| InChIKey | FHOQHVWUQLSEJG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |