C11H12Cl2FNO2 — CID 106183426
2-chloro-N-(1-chloro-3-methoxypropan-2-yl)-6-fluorobenzamide (PubChem CID 106183426) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is 2-chloro-N-(1-chloro-3-methoxypropan-2-yl)-6-fluorobenzamide.
| Compound Name | 2-chloro-N-(1-chloro-3-methoxypropan-2-yl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 106183426 |
| Molecular Formula | C11H12Cl2FNO2 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-chloro-N-(1-chloro-3-methoxypropan-2-yl)-6-fluorobenzamide |
| SMILES | COCC(CCl)NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C11H12Cl2FNO2/c1-17-6-7(5-12)15-11(16)10-8(13)3-2-4-9(10)14/h2-4,7H,5-6H2,1H3,(H,15,16) |
| InChIKey | VPQQVYAXRUDYSG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|