C10H10ClF2NO2 — CID 10999433
N-(2-chloro-1-methoxyethyl)-2,6-difluorobenzamide (PubChem CID 10999433) has the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. Its IUPAC name is N-(2-chloro-1-methoxyethyl)-2,6-difluorobenzamide.
| Compound Name | N-(2-chloro-1-methoxyethyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 10999433 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N-(2-chloro-1-methoxyethyl)-2,6-difluorobenzamide |
| SMILES | COC(CCl)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H10ClF2NO2/c1-16-8(5-11)14-10(15)9-6(12)3-2-4-7(9)13/h2-4,8H,5H2,1H3,(H,14,15) |
| InChIKey | AAHAEEHWYSJDFV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|