C12H14ClF2NO — CID 114305791
N-(5-chloropentan-2-yl)-2,6-difluorobenzamide (PubChem CID 114305791) has the molecular formula C12H14ClF2NO and a molecular weight of 261.70 g/mol. Its IUPAC name is N-(5-chloropentan-2-yl)-2,6-difluorobenzamide.
| Compound Name | N-(5-chloropentan-2-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 114305791 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(5-chloropentan-2-yl)-2,6-difluorobenzamide |
| SMILES | CC(CCCCl)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H14ClF2NO/c1-8(4-3-7-13)16-12(17)11-9(14)5-2-6-10(11)15/h2,5-6,8H,3-4,7H2,1H3,(H,16,17) |
| InChIKey | DZKJEHPFAHNSBG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|