C16H21F2NO3 — CID 6423118
4-methylpentyl 2-[(2,6-difluorobenzoyl)amino]propanoate (PubChem CID 6423118) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-methylpentyl 2-[(2,6-difluorobenzoyl)amino]propanoate.
| Compound Name | 4-methylpentyl 2-[(2,6-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 6423118 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-methylpentyl 2-[(2,6-difluorobenzoyl)amino]propanoate |
| SMILES | CC(C)CCCOC(=O)C(C)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H21F2NO3/c1-10(2)6-5-9-22-16(21)11(3)19-15(20)14-12(17)7-4-8-13(14)18/h4,7-8,10-11H,5-6,9H2,1-3H3,(H,19,20) |
| InChIKey | IZMZJNHGNTVQLE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|