C16H22ClNO3 — CID 91716474
4-methylpentyl 2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 91716474) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 4-methylpentyl 2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | 4-methylpentyl 2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 91716474 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-methylpentyl 2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | CC(C)CCCOC(=O)C(C)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClNO3/c1-11(2)7-6-10-21-16(20)12(3)18-15(19)13-8-4-5-9-14(13)17/h4-5,8-9,11-12H,6-7,10H2,1-3H3,(H,18,19) |
| InChIKey | OCACXILNDDMFBH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|