C17H22ClN3O5 — CID 42898503
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 42898503) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 42898503 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)C(C)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H22ClN3O5/c1-10(2)8-19-17(25)21-14(22)9-26-16(24)11(3)20-15(23)12-6-4-5-7-13(12)18/h4-7,10-11H,8-9H2,1-3H3,(H,20,23)(H2,19,21,22,25) |
| InChIKey | DLNUHXQQEGFZRI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |