C19H18Cl2N2O4 — CID 7570879
[2-[(3-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 7570879) has the molecular formula C19H18Cl2N2O4 and a molecular weight of 409.27 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7570879 |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [2-[(3-chlorophenyl)methylamino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccccc1Cl)C(=O)OCC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O4/c1-12(23-18(25)15-7-2-3-8-16(15)21)19(26)27-11-17(24)22-10-13-5-4-6-14(20)9-13/h2-9,12H,10-11H2,1H3,(H,22,24)(H,23,25)/t12-/m0/s1 |
| InChIKey | QLAWNTWRGUQRHO-LBPRGKRZSA-N |
| XLogP | 2.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |