C20H22ClNO4 — CID 55307071
2-(3-ethylphenoxy)ethyl 2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 55307071) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55307071 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | CCc1cccc(OCCOC(=O)C(C)NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H22ClNO4/c1-3-15-7-6-8-16(13-15)25-11-12-26-20(24)14(2)22-19(23)17-9-4-5-10-18(17)21/h4-10,13-14H,3,11-12H2,1-2H3,(H,22,23) |
| InChIKey | HZDZSMZEOLIJQS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|