C19H20FNO4 — CID 55316806
2-(3-ethylphenoxy)ethyl 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 55316806) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55316806 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | CCc1cccc(OCCOC(=O)CNC(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C19H20FNO4/c1-2-14-6-5-7-15(12-14)24-10-11-25-18(22)13-21-19(23)16-8-3-4-9-17(16)20/h3-9,12H,2,10-11,13H2,1H3,(H,21,23) |
| InChIKey | XGVHIQWXQHIWNO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|