C19H20ClNO5 — CID 16526656
2-(3-chlorophenoxy)ethyl 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 16526656) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 16526656 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)OCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO5/c1-2-24-17-9-4-3-8-16(17)19(23)21-13-18(22)26-11-10-25-15-7-5-6-14(20)12-15/h3-9,12H,2,10-11,13H2,1H3,(H,21,23) |
| InChIKey | WROGNUJIQOYFEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|