C19H19Cl2NO5 — CID 7843780
2-(4-ethoxyphenoxy)ethyl 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 7843780) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7843780 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | CCOc1ccc(OCCOC(=O)CNC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2NO5/c1-2-25-14-4-6-15(7-5-14)26-9-10-27-18(23)12-22-19(24)16-8-3-13(20)11-17(16)21/h3-8,11H,2,9-10,12H2,1H3,(H,22,24) |
| InChIKey | HYDQANSZFQAEJF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|