C19H17Cl2NO5 — CID 9270722
[2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 9270722) has the molecular formula C19H17Cl2NO5 and a molecular weight of 410.25 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9270722 |
| Molecular Formula | C19H17Cl2NO5 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | CCOc1ccc(C(=O)COC(=O)CNC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2NO5/c1-2-26-14-6-3-12(4-7-14)17(23)11-27-18(24)10-22-19(25)15-8-5-13(20)9-16(15)21/h3-9H,2,10-11H2,1H3,(H,22,25) |
| InChIKey | LOHUDYQUISDCEF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |