C17H15Cl2NO4 — CID 7843771
2-phenoxyethyl 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 7843771) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | 2-phenoxyethyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7843771 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2-phenoxyethyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1Cl)OCCOc1ccccc1 |
| InChI | InChI=1S/C17H15Cl2NO4/c18-12-6-7-14(15(19)10-12)17(22)20-11-16(21)24-9-8-23-13-4-2-1-3-5-13/h1-7,10H,8-9,11H2,(H,20,22) |
| InChIKey | QOHWDIFHQNXTBG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|