C21H18ClNO4 — CID 7881097
2-(4-chlorophenoxy)ethyl 2-(naphthalene-2-carbonylamino)acetate (PubChem CID 7881097) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 2-(naphthalene-2-carbonylamino)acetate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 2-(naphthalene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7881097 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 2-(naphthalene-2-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1ccc2ccccc2c1)OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClNO4/c22-18-7-9-19(10-8-18)26-11-12-27-20(24)14-23-21(25)17-6-5-15-3-1-2-4-16(15)13-17/h1-10,13H,11-12,14H2,(H,23,25) |
| InChIKey | OKPFMZGWSHWNGL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|