C23H18Cl2N2O4 — CID 35945777
[2-oxo-2-(4-phenylanilino)ethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 35945777) has the molecular formula C23H18Cl2N2O4 and a molecular weight of 457.31 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylanilino)ethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(4-phenylanilino)ethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 35945777 |
| Molecular Formula | C23H18Cl2N2O4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [2-oxo-2-(4-phenylanilino)ethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)cc1Cl)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O4/c24-17-8-11-19(20(25)12-17)23(30)26-13-22(29)31-14-21(28)27-18-9-6-16(7-10-18)15-4-2-1-3-5-15/h1-12H,13-14H2,(H,26,30)(H,27,28) |
| InChIKey | IHIOONVIHVZELB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |