C23H19Cl2N3O3 — CID 4796634
2,4-dichloro-N-[2-oxo-2-[[2-oxo-2-(4-phenylanilino)ethyl]amino]ethyl]benzamide (PubChem CID 4796634) has the molecular formula C23H19Cl2N3O3 and a molecular weight of 456.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-oxo-2-[[2-oxo-2-(4-phenylanilino)ethyl]amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-oxo-2-[[2-oxo-2-(4-phenylanilino)ethyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 4796634 |
| Molecular Formula | C23H19Cl2N3O3 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2,4-dichloro-N-[2-oxo-2-[[2-oxo-2-(4-phenylanilino)ethyl]amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1Cl)NCC(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O3/c24-17-8-11-19(20(25)12-17)23(31)27-13-21(29)26-14-22(30)28-18-9-6-16(7-10-18)15-4-2-1-3-5-15/h1-12H,13-14H2,(H,26,29)(H,27,31)(H,28,30) |
| InChIKey | CWUSRSASPRDNAM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |