C22H18Cl2N2O2 — CID 108570885
2,4-dichloro-N-[2-[(4-phenylbenzoyl)amino]ethyl]benzamide (PubChem CID 108570885) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(4-phenylbenzoyl)amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(4-phenylbenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108570885 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2,4-dichloro-N-[2-[(4-phenylbenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)cc1Cl)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O2/c23-18-10-11-19(20(24)14-18)22(28)26-13-12-25-21(27)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-11,14H,12-13H2,(H,25,27)(H,26,28) |
| InChIKey | GYOWLYRIUYXBHM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|