C20H14Cl2N2O2 — CID 4789053
2,5-dichloro-N'-(4-phenylbenzoyl)benzohydrazide (PubChem CID 4789053) has the molecular formula C20H14Cl2N2O2 and a molecular weight of 385.25 g/mol. Its IUPAC name is 2,5-dichloro-N'-(4-phenylbenzoyl)benzohydrazide.
| Compound Name | 2,5-dichloro-N'-(4-phenylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 4789053 |
| Molecular Formula | C20H14Cl2N2O2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2,5-dichloro-N'-(4-phenylbenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1cc(Cl)ccc1Cl)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14Cl2N2O2/c21-16-10-11-18(22)17(12-16)20(26)24-23-19(25)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H,23,25)(H,24,26) |
| InChIKey | BILLVCGXZXTHJP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|