C17H17Cl2N3O4S — CID 24634435
4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 24634435) has the molecular formula C17H17Cl2N3O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 24634435 |
| Molecular Formula | C17H17Cl2N3O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)NNC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O4S/c1-10(2)22-27(25,26)13-6-3-11(4-7-13)16(23)20-21-17(24)14-9-12(18)5-8-15(14)19/h3-10,22H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | LGDHWKIWVHBLST-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|