C15H13Cl2N3O4S — CID 9442420
4-chloro-3-[[(4-chlorobenzoyl)amino]carbamoyl]-N-methylbenzenesulfonamide (PubChem CID 9442420) has the molecular formula C15H13Cl2N3O4S and a molecular weight of 402.26 g/mol. Its IUPAC name is 4-chloro-3-[[(4-chlorobenzoyl)amino]carbamoyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-chloro-3-[[(4-chlorobenzoyl)amino]carbamoyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9442420 |
| Molecular Formula | C15H13Cl2N3O4S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 4-chloro-3-[[(4-chlorobenzoyl)amino]carbamoyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NNC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H13Cl2N3O4S/c1-18-25(23,24)11-6-7-13(17)12(8-11)15(22)20-19-14(21)9-2-4-10(16)5-3-9/h2-8,18H,1H3,(H,19,21)(H,20,22) |
| InChIKey | NARQQVURPMWSGE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|