C13H19ClN4O4S2 — CID 9477944
1-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9477944) has the molecular formula C13H19ClN4O4S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 1-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9477944 |
| Molecular Formula | C13H19ClN4O4S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NNC(=S)N[C@H](C)COC)c1 |
| InChI | InChI=1S/C13H19ClN4O4S2/c1-8(7-22-3)16-13(23)18-17-12(19)10-6-9(4-5-11(10)14)24(20,21)15-2/h4-6,8,15H,7H2,1-3H3,(H,17,19)(H2,16,18,23)/t8-/m1/s1 |
| InChIKey | JPKBKXBXVKIZTB-MRVPVSSYSA-N |
| XLogP | 0.39 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|