C22H21ClN2O3S — CID 56523646
2-chloro-N-(1,1-diphenylethyl)-5-(methylsulfamoyl)benzamide (PubChem CID 56523646) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is 2-chloro-N-(1,1-diphenylethyl)-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-(1,1-diphenylethyl)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56523646 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-chloro-N-(1,1-diphenylethyl)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NC(C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H21ClN2O3S/c1-22(16-9-5-3-6-10-16,17-11-7-4-8-12-17)25-21(26)19-15-18(13-14-20(19)23)29(27,28)24-2/h3-15,24H,1-2H3,(H,25,26) |
| InChIKey | NGCOMNBGVFOPMH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |