C17H18ClN3O4S — CID 38196368
N-(2-benzamidoethyl)-2-chloro-5-(methylsulfamoyl)benzamide (PubChem CID 38196368) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-2-chloro-5-(methylsulfamoyl)benzamide.
| Compound Name | N-(2-benzamidoethyl)-2-chloro-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 38196368 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(2-benzamidoethyl)-2-chloro-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NCCNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H18ClN3O4S/c1-19-26(24,25)13-7-8-15(18)14(11-13)17(23)21-10-9-20-16(22)12-5-3-2-4-6-12/h2-8,11,19H,9-10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | WGJXUINRGNHOTG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|