C16H16ClN5O3S — CID 55729345
2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-5-(methylsulfamoyl)benzamide (PubChem CID 55729345) has the molecular formula C16H16ClN5O3S and a molecular weight of 393.86 g/mol. Its IUPAC name is 2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55729345 |
| Molecular Formula | C16H16ClN5O3S |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NCCNc2ncccc2C#N)c1 |
| InChI | InChI=1S/C16H16ClN5O3S/c1-19-26(24,25)12-4-5-14(17)13(9-12)16(23)22-8-7-21-15-11(10-18)3-2-6-20-15/h2-6,9,19H,7-8H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | JUWCDKBHXHMWSL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|