C15H13ClN4O — CID 46443949
2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide (PubChem CID 46443949) has the molecular formula C15H13ClN4O and a molecular weight of 300.75 g/mol. Its IUPAC name is 2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 46443949 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-chloro-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H13ClN4O/c16-13-6-2-1-5-12(13)15(21)20-9-8-19-14-11(10-17)4-3-7-18-14/h1-7H,8-9H2,(H,18,19)(H,20,21) |
| InChIKey | AJPXBNMPUXWPBW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|