C24H25N5O — CID 55770075
1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-(3,3-diphenylpropyl)urea (PubChem CID 55770075) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-(3,3-diphenylpropyl)urea.
| Compound Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 55770075 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-(3,3-diphenylpropyl)urea |
| SMILES | N#Cc1cccnc1NCCNC(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25N5O/c25-18-21-12-7-14-26-23(21)27-16-17-29-24(30)28-15-13-22(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-12,14,22H,13,15-17H2,(H,26,27)(H2,28,29,30) |
| InChIKey | KPMAMUVUEUUZNY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|