C23H21N5O2 — CID 55727986
N-[2-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 55727986) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[2-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-[2-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 55727986 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[2-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)CNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N5O2/c24-15-20-7-4-12-26-22(20)27-14-13-25-21(29)16-28-23(30)19-10-8-18(9-11-19)17-5-2-1-3-6-17/h1-12H,13-14,16H2,(H,25,29)(H,26,27)(H,28,30) |
| InChIKey | XTYVNFRSRCOGCP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|