C19H21BrN4O — CID 55840184
5-(4-bromophenyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]pentanamide (PubChem CID 55840184) has the molecular formula C19H21BrN4O and a molecular weight of 401.31 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 55840184 |
| Molecular Formula | C19H21BrN4O |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 5-(4-bromophenyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]pentanamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)CCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrN4O/c20-17-9-7-15(8-10-17)4-1-2-6-18(25)22-12-13-24-19-16(14-21)5-3-11-23-19/h3,5,7-11H,1-2,4,6,12-13H2,(H,22,25)(H,23,24) |
| InChIKey | YRBCKYIOTXTUNT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|