C19H22BrNO — CID 55752390
5-(4-bromophenyl)-N-(2-phenylethyl)pentanamide (PubChem CID 55752390) has the molecular formula C19H22BrNO and a molecular weight of 360.29 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(2-phenylethyl)pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 55752390 |
| Molecular Formula | C19H22BrNO |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 5-(4-bromophenyl)-N-(2-phenylethyl)pentanamide |
| SMILES | O=C(CCCCc1ccc(Br)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C19H22BrNO/c20-18-12-10-17(11-13-18)8-4-5-9-19(22)21-15-14-16-6-2-1-3-7-16/h1-3,6-7,10-13H,4-5,8-9,14-15H2,(H,21,22) |
| InChIKey | UFORKDLKOZGIDD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|