C18H21NO4S — CID 23037515
4-[4-oxo-4-(2-phenylethylamino)butyl]benzenesulfonic acid (PubChem CID 23037515) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-[4-oxo-4-(2-phenylethylamino)butyl]benzenesulfonic acid.
| Compound Name | 4-[4-oxo-4-(2-phenylethylamino)butyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 23037515 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[4-oxo-4-(2-phenylethylamino)butyl]benzenesulfonic acid |
| SMILES | O=C(CCCc1ccc(S(=O)(=O)O)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c20-18(19-14-13-15-5-2-1-3-6-15)8-4-7-16-9-11-17(12-10-16)24(21,22)23/h1-3,5-6,9-12H,4,7-8,13-14H2,(H,19,20)(H,21,22,23) |
| InChIKey | KZMBFJVWTFROSN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|