C15H12F2N4O — CID 60556332
N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-difluorobenzamide (PubChem CID 60556332) has the molecular formula C15H12F2N4O and a molecular weight of 302.28 g/mol. Its IUPAC name is N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 60556332 |
| Molecular Formula | C15H12F2N4O |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-difluorobenzamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H12F2N4O/c16-11-4-1-5-12(17)13(11)15(22)21-8-7-20-14-10(9-18)3-2-6-19-14/h1-6H,7-8H2,(H,19,20)(H,21,22) |
| InChIKey | UBYPLLHSLSZULN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|