C16H12ClF2N3O — CID 133352839
N-[2-(2-chloro-6-cyanoanilino)ethyl]-2,6-difluorobenzamide (PubChem CID 133352839) has the molecular formula C16H12ClF2N3O and a molecular weight of 335.74 g/mol. Its IUPAC name is N-[2-(2-chloro-6-cyanoanilino)ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-(2-chloro-6-cyanoanilino)ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 133352839 |
| Molecular Formula | C16H12ClF2N3O |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[2-(2-chloro-6-cyanoanilino)ethyl]-2,6-difluorobenzamide |
| SMILES | N#Cc1cccc(Cl)c1NCCNC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H12ClF2N3O/c17-11-4-1-3-10(9-20)15(11)21-7-8-22-16(23)14-12(18)5-2-6-13(14)19/h1-6,21H,7-8H2,(H,22,23) |
| InChIKey | AIGXKTVRUJIPLS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|