C19H15ClN4O — CID 133316214
2-chloro-N-[2-[(3-cyanoquinolin-4-yl)amino]ethyl]benzamide (PubChem CID 133316214) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is 2-chloro-N-[2-[(3-cyanoquinolin-4-yl)amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[(3-cyanoquinolin-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133316214 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-chloro-N-[2-[(3-cyanoquinolin-4-yl)amino]ethyl]benzamide |
| SMILES | N#Cc1cnc2ccccc2c1NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H15ClN4O/c20-16-7-3-1-5-14(16)19(25)23-10-9-22-18-13(11-21)12-24-17-8-4-2-6-15(17)18/h1-8,12H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | XMOXOLHNJIUGHG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|