C13H13N3 — CID 43668866
4-(propylamino)quinoline-3-carbonitrile (PubChem CID 43668866) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 4-(propylamino)quinoline-3-carbonitrile.
| Compound Name | 4-(propylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 43668866 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-(propylamino)quinoline-3-carbonitrile |
| SMILES | CCCNc1c(C#N)cnc2ccccc12 |
| InChI | InChI=1S/C13H13N3/c1-2-7-15-13-10(8-14)9-16-12-6-4-3-5-11(12)13/h3-6,9H,2,7H2,1H3,(H,15,16) |
| InChIKey | LBJGBPWEMCVGBB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |