C17H15N3 — CID 62188673
4-(propylamino)benzo[h]quinoline-3-carbonitrile (PubChem CID 62188673) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-(propylamino)benzo[h]quinoline-3-carbonitrile.
| Compound Name | 4-(propylamino)benzo[h]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 62188673 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-(propylamino)benzo[h]quinoline-3-carbonitrile |
| SMILES | CCCNc1c(C#N)cnc2c1ccc1ccccc12 |
| InChI | InChI=1S/C17H15N3/c1-2-9-19-16-13(10-18)11-20-17-14-6-4-3-5-12(14)7-8-15(16)17/h3-8,11H,2,9H2,1H3,(H,19,20) |
| InChIKey | YDVZHASMXKSXEY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|