C13H11Cl2N3 — CID 55045002
5,8-dichloro-4-(propylamino)quinoline-3-carbonitrile (PubChem CID 55045002) has the molecular formula C13H11Cl2N3 and a molecular weight of 280.16 g/mol. Its IUPAC name is 5,8-dichloro-4-(propylamino)quinoline-3-carbonitrile.
| Compound Name | 5,8-dichloro-4-(propylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 55045002 |
| Molecular Formula | C13H11Cl2N3 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 5,8-dichloro-4-(propylamino)quinoline-3-carbonitrile |
| SMILES | CCCNc1c(C#N)cnc2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C13H11Cl2N3/c1-2-5-17-12-8(6-16)7-18-13-10(15)4-3-9(14)11(12)13/h3-4,7H,2,5H2,1H3,(H,17,18) |
| InChIKey | WYWNQHGMNYDSMP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |