C12H8Cl3N3 — CID 55045004
5,6,8-trichloro-4-(ethylamino)quinoline-3-carbonitrile (PubChem CID 55045004) has the molecular formula C12H8Cl3N3 and a molecular weight of 300.58 g/mol. Its IUPAC name is 5,6,8-trichloro-4-(ethylamino)quinoline-3-carbonitrile.
| Compound Name | 5,6,8-trichloro-4-(ethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 55045004 |
| Molecular Formula | C12H8Cl3N3 |
| Molecular Weight | 300.58 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 5,6,8-trichloro-4-(ethylamino)quinoline-3-carbonitrile |
| SMILES | CCNc1c(C#N)cnc2c(Cl)cc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C12H8Cl3N3/c1-2-17-11-6(4-16)5-18-12-8(14)3-7(13)10(15)9(11)12/h3,5H,2H2,1H3,(H,17,18) |
| InChIKey | WSYCLGMCEZHJSD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|