C13H11F2N3 — CID 103587304
4-(ethylamino)-5,8-difluoro-6-methylquinoline-3-carbonitrile (PubChem CID 103587304) has the molecular formula C13H11F2N3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-(ethylamino)-5,8-difluoro-6-methylquinoline-3-carbonitrile.
| Compound Name | 4-(ethylamino)-5,8-difluoro-6-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 103587304 |
| Molecular Formula | C13H11F2N3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 4-(ethylamino)-5,8-difluoro-6-methylquinoline-3-carbonitrile |
| SMILES | CCNc1c(C#N)cnc2c(F)cc(C)c(F)c12 |
| InChI | InChI=1S/C13H11F2N3/c1-3-17-12-8(5-16)6-18-13-9(14)4-7(2)11(15)10(12)13/h4,6H,3H2,1-2H3,(H,17,18) |
| InChIKey | GURBABWSBLASAL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |