C15H18F2N2 — CID 103587346
5,8-difluoro-2,3,6-trimethyl-N-propylquinolin-4-amine (PubChem CID 103587346) has the molecular formula C15H18F2N2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5,8-difluoro-2,3,6-trimethyl-N-propylquinolin-4-amine.
| Compound Name | 5,8-difluoro-2,3,6-trimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 103587346 |
| Molecular Formula | C15H18F2N2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5,8-difluoro-2,3,6-trimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C)c(C)nc2c(F)cc(C)c(F)c12 |
| InChI | InChI=1S/C15H18F2N2/c1-5-6-18-14-9(3)10(4)19-15-11(16)7-8(2)13(17)12(14)15/h7H,5-6H2,1-4H3,(H,18,19) |
| InChIKey | WRZBTNDPZCAJMY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |