C17H23FN2 — CID 63479938
8-fluoro-2,6-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine (PubChem CID 63479938) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is 8-fluoro-2,6-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine.
| Compound Name | 8-fluoro-2,6-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63479938 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 8-fluoro-2,6-dimethyl-3-propan-2-yl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(C(C)C)c(C)nc2c(F)cc(C)cc12 |
| InChI | InChI=1S/C17H23FN2/c1-6-7-19-17-13-8-11(4)9-14(18)16(13)20-12(5)15(17)10(2)3/h8-10H,6-7H2,1-5H3,(H,19,20) |
| InChIKey | HSZQWTKBHGPPGB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |